C8H13N3O2 — CID 103218636
2-(2-methoxyethyl)-5-(methylamino)pyridazin-3-one (PubChem CID 103218636) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-5-(methylamino)pyridazin-3-one.
| Compound Name | 2-(2-methoxyethyl)-5-(methylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 103218636 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 2-(2-methoxyethyl)-5-(methylamino)pyridazin-3-one |
| SMILES | CNc1cnn(CCOC)c(=O)c1 |
| InChI | InChI=1S/C8H13N3O2/c1-9-7-5-8(12)11(10-6-7)3-4-13-2/h5-6,9H,3-4H2,1-2H3 |
| InChIKey | QYJKJIZWBRHJIW-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |