C8H10F3N3O2 — CID 103218426
5-amino-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyridazin-3-one (PubChem CID 103218426) has the molecular formula C8H10F3N3O2 and a molecular weight of 237.18 g/mol. Its IUPAC name is 5-amino-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyridazin-3-one.
| Compound Name | 5-amino-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 103218426 |
| Molecular Formula | C8H10F3N3O2 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 5-amino-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyridazin-3-one |
| SMILES | Nc1cnn(CCOCC(F)(F)F)c(=O)c1 |
| InChI | InChI=1S/C8H10F3N3O2/c9-8(10,11)5-16-2-1-14-7(15)3-6(12)4-13-14/h3-4H,1-2,5,12H2 |
| InChIKey | CLIPXEQQRSSCJK-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|