C12H18F3N3O2 — CID 103220334
5-(propylamino)-2-[3-(2,2,2-trifluoroethoxy)propyl]pyridazin-3-one (PubChem CID 103220334) has the molecular formula C12H18F3N3O2 and a molecular weight of 293.29 g/mol. Its IUPAC name is 5-(propylamino)-2-[3-(2,2,2-trifluoroethoxy)propyl]pyridazin-3-one.
| Compound Name | 5-(propylamino)-2-[3-(2,2,2-trifluoroethoxy)propyl]pyridazin-3-one |
|---|---|
| PubChem CID | 103220334 |
| Molecular Formula | C12H18F3N3O2 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 5-(propylamino)-2-[3-(2,2,2-trifluoroethoxy)propyl]pyridazin-3-one |
| SMILES | CCCNc1cnn(CCCOCC(F)(F)F)c(=O)c1 |
| InChI | InChI=1S/C12H18F3N3O2/c1-2-4-16-10-7-11(19)18(17-8-10)5-3-6-20-9-12(13,14)15/h7-8,16H,2-6,9H2,1H3 |
| InChIKey | YXKMMBFEFRHQHF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|