C12H16F3N3O2 — CID 103219987
5-(cyclopropylamino)-2-[3-(2,2,2-trifluoroethoxy)propyl]pyridazin-3-one (PubChem CID 103219987) has the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. Its IUPAC name is 5-(cyclopropylamino)-2-[3-(2,2,2-trifluoroethoxy)propyl]pyridazin-3-one.
| Compound Name | 5-(cyclopropylamino)-2-[3-(2,2,2-trifluoroethoxy)propyl]pyridazin-3-one |
|---|---|
| PubChem CID | 103219987 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 5-(cyclopropylamino)-2-[3-(2,2,2-trifluoroethoxy)propyl]pyridazin-3-one |
| SMILES | O=c1cc(NC2CC2)cnn1CCCOCC(F)(F)F |
| InChI | InChI=1S/C12H16F3N3O2/c13-12(14,15)8-20-5-1-4-18-11(19)6-10(7-16-18)17-9-2-3-9/h6-7,9,17H,1-5,8H2 |
| InChIKey | WWKVAXZHVPLXBG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|