C13H18F3N3O2 — CID 103220694
5-(cyclobutylamino)-2-[3-(2,2,2-trifluoroethoxy)propyl]pyridazin-3-one (PubChem CID 103220694) has the molecular formula C13H18F3N3O2 and a molecular weight of 305.30 g/mol. Its IUPAC name is 5-(cyclobutylamino)-2-[3-(2,2,2-trifluoroethoxy)propyl]pyridazin-3-one.
| Compound Name | 5-(cyclobutylamino)-2-[3-(2,2,2-trifluoroethoxy)propyl]pyridazin-3-one |
|---|---|
| PubChem CID | 103220694 |
| Molecular Formula | C13H18F3N3O2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 5-(cyclobutylamino)-2-[3-(2,2,2-trifluoroethoxy)propyl]pyridazin-3-one |
| SMILES | O=c1cc(NC2CCC2)cnn1CCCOCC(F)(F)F |
| InChI | InChI=1S/C13H18F3N3O2/c14-13(15,16)9-21-6-2-5-19-12(20)7-11(8-17-19)18-10-3-1-4-10/h7-8,10,18H,1-6,9H2 |
| InChIKey | CVTNWLXBZCHXJM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|