C11H17F3N4O2 — CID 103221265
5-(2-aminoethylamino)-2-[3-(2,2,2-trifluoroethoxy)propyl]pyridazin-3-one (PubChem CID 103221265) has the molecular formula C11H17F3N4O2 and a molecular weight of 294.28 g/mol. Its IUPAC name is 5-(2-aminoethylamino)-2-[3-(2,2,2-trifluoroethoxy)propyl]pyridazin-3-one.
| Compound Name | 5-(2-aminoethylamino)-2-[3-(2,2,2-trifluoroethoxy)propyl]pyridazin-3-one |
|---|---|
| PubChem CID | 103221265 |
| Molecular Formula | C11H17F3N4O2 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 5-(2-aminoethylamino)-2-[3-(2,2,2-trifluoroethoxy)propyl]pyridazin-3-one |
| SMILES | NCCNc1cnn(CCCOCC(F)(F)F)c(=O)c1 |
| InChI | InChI=1S/C11H17F3N4O2/c12-11(13,14)8-20-5-1-4-18-10(19)6-9(7-17-18)16-3-2-15/h6-7,16H,1-5,8,15H2 |
| InChIKey | AQWKXKOKINDOFX-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|