C15H15N3OS — CID 103218855
2-(1-benzothiophen-3-ylmethyl)-5-(ethylamino)pyridazin-3-one (PubChem CID 103218855) has the molecular formula C15H15N3OS and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-ylmethyl)-5-(ethylamino)pyridazin-3-one.
| Compound Name | 2-(1-benzothiophen-3-ylmethyl)-5-(ethylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 103218855 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 2-(1-benzothiophen-3-ylmethyl)-5-(ethylamino)pyridazin-3-one |
| SMILES | CCNc1cnn(Cc2csc3ccccc23)c(=O)c1 |
| InChI | InChI=1S/C15H15N3OS/c1-2-16-12-7-15(19)18(17-8-12)9-11-10-20-14-6-4-3-5-13(11)14/h3-8,10,16H,2,9H2,1H3 |
| InChIKey | HCIYUWPSEDWXTF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |