C15H14BrN3OS — CID 133303580
5-[2-(1-benzothiophen-3-yl)ethylamino]-4-bromo-2-methylpyridazin-3-one (PubChem CID 133303580) has the molecular formula C15H14BrN3OS and a molecular weight of 364.27 g/mol. Its IUPAC name is 5-[2-(1-benzothiophen-3-yl)ethylamino]-4-bromo-2-methylpyridazin-3-one.
| Compound Name | 5-[2-(1-benzothiophen-3-yl)ethylamino]-4-bromo-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 133303580 |
| Molecular Formula | C15H14BrN3OS |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | 5-[2-(1-benzothiophen-3-yl)ethylamino]-4-bromo-2-methylpyridazin-3-one |
| SMILES | Cn1ncc(NCCc2csc3ccccc23)c(Br)c1=O |
| InChI | InChI=1S/C15H14BrN3OS/c1-19-15(20)14(16)12(8-18-19)17-7-6-10-9-21-13-5-3-2-4-11(10)13/h2-5,8-9,17H,6-7H2,1H3 |
| InChIKey | OOCCDOPNJOSVJZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |