C16H20BrN3O3 — CID 133403053
4-bromo-5-[3-(2,5-dimethoxyphenyl)propylamino]-2-methylpyridazin-3-one (PubChem CID 133403053) has the molecular formula C16H20BrN3O3 and a molecular weight of 382.26 g/mol. Its IUPAC name is 4-bromo-5-[3-(2,5-dimethoxyphenyl)propylamino]-2-methylpyridazin-3-one.
| Compound Name | 4-bromo-5-[3-(2,5-dimethoxyphenyl)propylamino]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 133403053 |
| Molecular Formula | C16H20BrN3O3 |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 4-bromo-5-[3-(2,5-dimethoxyphenyl)propylamino]-2-methylpyridazin-3-one |
| SMILES | COc1ccc(OC)c(CCCNc2cnn(C)c(=O)c2Br)c1 |
| InChI | InChI=1S/C16H20BrN3O3/c1-20-16(21)15(17)13(10-19-20)18-8-4-5-11-9-12(22-2)6-7-14(11)23-3/h6-7,9-10,18H,4-5,8H2,1-3H3 |
| InChIKey | KBAUGHWGCJXQBP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|