C16H20BrN3O2 — CID 133353632
4-bromo-5-[3-(4-methoxyphenyl)butylamino]-2-methylpyridazin-3-one (PubChem CID 133353632) has the molecular formula C16H20BrN3O2 and a molecular weight of 366.26 g/mol. Its IUPAC name is 4-bromo-5-[3-(4-methoxyphenyl)butylamino]-2-methylpyridazin-3-one.
| Compound Name | 4-bromo-5-[3-(4-methoxyphenyl)butylamino]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 133353632 |
| Molecular Formula | C16H20BrN3O2 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 4-bromo-5-[3-(4-methoxyphenyl)butylamino]-2-methylpyridazin-3-one |
| SMILES | COc1ccc(C(C)CCNc2cnn(C)c(=O)c2Br)cc1 |
| InChI | InChI=1S/C16H20BrN3O2/c1-11(12-4-6-13(22-3)7-5-12)8-9-18-14-10-19-20(2)16(21)15(14)17/h4-7,10-11,18H,8-9H2,1-3H3 |
| InChIKey | CCYHHMNGKZHHKS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |