C10H13BrN6O — CID 113239915
4-bromo-2-methyl-5-[3-(1H-1,2,4-triazol-5-yl)propylamino]pyridazin-3-one (PubChem CID 113239915) has the molecular formula C10H13BrN6O and a molecular weight of 313.16 g/mol. Its IUPAC name is 4-bromo-2-methyl-5-[3-(1H-1,2,4-triazol-5-yl)propylamino]pyridazin-3-one.
| Compound Name | 4-bromo-2-methyl-5-[3-(1H-1,2,4-triazol-5-yl)propylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 113239915 |
| Molecular Formula | C10H13BrN6O |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 4-bromo-2-methyl-5-[3-(1H-1,2,4-triazol-5-yl)propylamino]pyridazin-3-one |
| SMILES | Cn1ncc(NCCCc2ncn[nH]2)c(Br)c1=O |
| InChI | InChI=1S/C10H13BrN6O/c1-17-10(18)9(11)7(5-15-17)12-4-2-3-8-13-6-14-16-8/h5-6,12H,2-4H2,1H3,(H,13,14,16) |
| InChIKey | HEVRRSUZWVNBNX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|