C9H15N3O2 — CID 103219065
5-(ethylamino)-2-(2-methoxyethyl)pyridazin-3-one (PubChem CID 103219065) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 5-(ethylamino)-2-(2-methoxyethyl)pyridazin-3-one.
| Compound Name | 5-(ethylamino)-2-(2-methoxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 103219065 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 5-(ethylamino)-2-(2-methoxyethyl)pyridazin-3-one |
| SMILES | CCNc1cnn(CCOC)c(=O)c1 |
| InChI | InChI=1S/C9H15N3O2/c1-3-10-8-6-9(13)12(11-7-8)4-5-14-2/h6-7,10H,3-5H2,1-2H3 |
| InChIKey | FRUVBZREDJPJBY-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |