C33H48O — CID 10322030
(1S,2Z,4E,10R,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-5-phenyltricyclo[8.7.0.011,15]heptadeca-2,4-dien-7-one (PubChem CID 10322030) has the molecular formula C33H48O and a molecular weight of 460.75 g/mol. Its IUPAC name is (1S,2Z,4E,10R,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-5-phenyltricyclo[8.7.0.011,15]heptadeca-2,4-dien-7-one.
| Compound Name | (1S,2Z,4E,10R,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-5-phenyltricyclo[8.7.0.011,15]heptadeca-2,4-dien-7-one |
|---|---|
| PubChem CID | 10322030 |
| Molecular Formula | C33H48O |
| Molecular Weight | 460.75 g/mol |
| Exact Mass | 460.37 |
| IUPAC Name | (1S,2Z,4E,10R,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-5-phenyltricyclo[8.7.0.011,15]heptadeca-2,4-dien-7-one |
| SMILES | C/C1=C/C=C(/c2ccccc2)CC(=O)CC[C@@H]2[C@@H]1CC[C@]1(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@@H]21 |
| InChI | InChI=1S/C33H48O/c1-23(2)10-9-11-25(4)31-18-19-32-30-17-16-28(34)22-27(26-12-7-6-8-13-26)15-14-24(3)29(30)20-21-33(31,32)5/h6-8,12-15,23,25,29-32H,9-11,16-22H2,1-5H3/b24-14-,27-15+/t25-,29-,30-,31-,32+,33-/m1/s1 |
| InChIKey | QHGCCZKXFRFCAH-QVJNNKLXSA-N |
| XLogP | 9.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.75 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |