C27H44O2 — CID 10597143
(1S,10R,11S,14R,15R)-15-methyl-14-[(2R)-6-methylheptan-2-yl]-2-methylidenetricyclo[8.7.0.011,15]heptadecane-5,7-dione (PubChem CID 10597143) has the molecular formula C27H44O2 and a molecular weight of 400.65 g/mol. Its IUPAC name is (1S,10R,11S,14R,15R)-15-methyl-14-[(2R)-6-methylheptan-2-yl]-2-methylidenetricyclo[8.7.0.011,15]heptadecane-5,7-dione.
| Compound Name | (1S,10R,11S,14R,15R)-15-methyl-14-[(2R)-6-methylheptan-2-yl]-2-methylidenetricyclo[8.7.0.011,15]heptadecane-5,7-dione |
|---|---|
| PubChem CID | 10597143 |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | (1S,10R,11S,14R,15R)-15-methyl-14-[(2R)-6-methylheptan-2-yl]-2-methylidenetricyclo[8.7.0.011,15]heptadecane-5,7-dione |
| SMILES | C=C1CCC(=O)CC(=O)CC[C@@H]2[C@@H]1CC[C@]1(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@@H]21 |
| InChI | InChI=1S/C27H44O2/c1-18(2)7-6-8-20(4)25-13-14-26-24-12-11-22(29)17-21(28)10-9-19(3)23(24)15-16-27(25,26)5/h18,20,23-26H,3,6-17H2,1-2,4-5H3/t20-,23-,24-,25-,26+,27-/m1/s1 |
| InChIKey | XGZCQFPDYBJRGD-IHAALCJSSA-N |
| XLogP | 7.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|