C13H23N5O — CID 103221032
5-(2-aminoethylamino)-2-(3-pyrrolidin-1-ylpropyl)pyridazin-3-one (PubChem CID 103221032) has the molecular formula C13H23N5O and a molecular weight of 265.36 g/mol. Its IUPAC name is 5-(2-aminoethylamino)-2-(3-pyrrolidin-1-ylpropyl)pyridazin-3-one.
| Compound Name | 5-(2-aminoethylamino)-2-(3-pyrrolidin-1-ylpropyl)pyridazin-3-one |
|---|---|
| PubChem CID | 103221032 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 5-(2-aminoethylamino)-2-(3-pyrrolidin-1-ylpropyl)pyridazin-3-one |
| SMILES | NCCNc1cnn(CCCN2CCCC2)c(=O)c1 |
| InChI | InChI=1S/C13H23N5O/c14-4-5-15-12-10-13(19)18(16-11-12)9-3-8-17-6-1-2-7-17/h10-11,15H,1-9,14H2 |
| InChIKey | SXYUTIVYJDCIEI-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |