C11H20N4OS — CID 103221311
5-(2-aminoethylamino)-2-(3-ethylsulfanylpropyl)pyridazin-3-one (PubChem CID 103221311) has the molecular formula C11H20N4OS and a molecular weight of 256.37 g/mol. Its IUPAC name is 5-(2-aminoethylamino)-2-(3-ethylsulfanylpropyl)pyridazin-3-one.
| Compound Name | 5-(2-aminoethylamino)-2-(3-ethylsulfanylpropyl)pyridazin-3-one |
|---|---|
| PubChem CID | 103221311 |
| Molecular Formula | C11H20N4OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 5-(2-aminoethylamino)-2-(3-ethylsulfanylpropyl)pyridazin-3-one |
| SMILES | CCSCCCn1ncc(NCCN)cc1=O |
| InChI | InChI=1S/C11H20N4OS/c1-2-17-7-3-6-15-11(16)8-10(9-14-15)13-5-4-12/h8-9,13H,2-7,12H2,1H3 |
| InChIKey | JSQLJSREQDVMJA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|