C14H20N4O2S — CID 45222982
2-(6-oxo-4-pyrrolidin-1-ylpyridazin-1-yl)-N-(thiolan-3-yl)acetamide (PubChem CID 45222982) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 2-(6-oxo-4-pyrrolidin-1-ylpyridazin-1-yl)-N-(thiolan-3-yl)acetamide.
| Compound Name | 2-(6-oxo-4-pyrrolidin-1-ylpyridazin-1-yl)-N-(thiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 45222982 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-(6-oxo-4-pyrrolidin-1-ylpyridazin-1-yl)-N-(thiolan-3-yl)acetamide |
| SMILES | O=C(Cn1ncc(N2CCCC2)cc1=O)NC1CCSC1 |
| InChI | InChI=1S/C14H20N4O2S/c19-13(16-11-3-6-21-10-11)9-18-14(20)7-12(8-15-18)17-4-1-2-5-17/h7-8,11H,1-6,9-10H2,(H,16,19) |
| InChIKey | OLCPKEKGPBSPNG-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |