C17H17ClINO — CID 103221365
3-chloro-N-[(2,4-dimethylphenyl)methyl]-4-iodo-N-methylbenzamide (PubChem CID 103221365) has the molecular formula C17H17ClINO and a molecular weight of 413.69 g/mol. Its IUPAC name is 3-chloro-N-[(2,4-dimethylphenyl)methyl]-4-iodo-N-methylbenzamide.
| Compound Name | 3-chloro-N-[(2,4-dimethylphenyl)methyl]-4-iodo-N-methylbenzamide |
|---|---|
| PubChem CID | 103221365 |
| Molecular Formula | C17H17ClINO |
| Molecular Weight | 413.69 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | 3-chloro-N-[(2,4-dimethylphenyl)methyl]-4-iodo-N-methylbenzamide |
| SMILES | Cc1ccc(CN(C)C(=O)c2ccc(I)c(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C17H17ClINO/c1-11-4-5-14(12(2)8-11)10-20(3)17(21)13-6-7-16(19)15(18)9-13/h4-9H,10H2,1-3H3 |
| InChIKey | MNDQXZCUEPPAQY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.69 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|