C16H17BrN2O — CID 103753955
2-bromo-N-[(2,4-dimethylphenyl)methyl]-N-methylpyridine-4-carboxamide (PubChem CID 103753955) has the molecular formula C16H17BrN2O and a molecular weight of 333.23 g/mol. Its IUPAC name is 2-bromo-N-[(2,4-dimethylphenyl)methyl]-N-methylpyridine-4-carboxamide.
| Compound Name | 2-bromo-N-[(2,4-dimethylphenyl)methyl]-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 103753955 |
| Molecular Formula | C16H17BrN2O |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 2-bromo-N-[(2,4-dimethylphenyl)methyl]-N-methylpyridine-4-carboxamide |
| SMILES | Cc1ccc(CN(C)C(=O)c2ccnc(Br)c2)c(C)c1 |
| InChI | InChI=1S/C16H17BrN2O/c1-11-4-5-14(12(2)8-11)10-19(3)16(20)13-6-7-18-15(17)9-13/h4-9H,10H2,1-3H3 |
| InChIKey | JKIQPRJWKDYXTA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|