C28H48O5 — CID 10322223
ethyl (6R)-6-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoate (PubChem CID 10322223) has the molecular formula C28H48O5 and a molecular weight of 464.69 g/mol. Its IUPAC name is ethyl (6R)-6-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoate.
| Compound Name | ethyl (6R)-6-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoate |
|---|---|
| PubChem CID | 10322223 |
| Molecular Formula | C28H48O5 |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 464.35 |
| IUPAC Name | ethyl (6R)-6-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoate |
| SMILES | CCOC(=O)CCCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C |
| InChI | InChI=1S/C28H48O5/c1-5-33-25(32)9-7-6-8-17(2)20-10-11-21-26-22(16-24(31)28(20,21)4)27(3)13-12-19(29)14-18(27)15-23(26)30/h17-24,26,29-31H,5-16H2,1-4H3/t17-,18+,19-,20-,21+,22+,23-,24+,26+,27+,28-/m1/s1 |
| InChIKey | UTXHDKTUGVDXRP-SREHDYERSA-N |
| XLogP | 4.71 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|