C14H21N5O2 — CID 103223098
5-(2-aminopropoxy)-2-[(2-ethyl-5-methylpyrazol-3-yl)methyl]pyridazin-3-one (PubChem CID 103223098) has the molecular formula C14H21N5O2 and a molecular weight of 291.36 g/mol. Its IUPAC name is 5-(2-aminopropoxy)-2-[(2-ethyl-5-methylpyrazol-3-yl)methyl]pyridazin-3-one.
| Compound Name | 5-(2-aminopropoxy)-2-[(2-ethyl-5-methylpyrazol-3-yl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 103223098 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 5-(2-aminopropoxy)-2-[(2-ethyl-5-methylpyrazol-3-yl)methyl]pyridazin-3-one |
| SMILES | CCn1nc(C)cc1Cn1ncc(OCC(C)N)cc1=O |
| InChI | InChI=1S/C14H21N5O2/c1-4-18-12(5-11(3)17-18)8-19-14(20)6-13(7-16-19)21-9-10(2)15/h5-7,10H,4,8-9,15H2,1-3H3 |
| InChIKey | QLQKJRMWAWOKFL-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |