C26H34N4O2S — CID 10322312
1-[2-methyl-6-[3-(5-methyl-4-phenylimidazol-1-yl)propylsulfinyl]phenyl]-3-pentylurea (PubChem CID 10322312) has the molecular formula C26H34N4O2S and a molecular weight of 466.65 g/mol. Its IUPAC name is 1-[2-methyl-6-[3-(5-methyl-4-phenylimidazol-1-yl)propylsulfinyl]phenyl]-3-pentylurea.
| Compound Name | 1-[2-methyl-6-[3-(5-methyl-4-phenylimidazol-1-yl)propylsulfinyl]phenyl]-3-pentylurea |
|---|---|
| PubChem CID | 10322312 |
| Molecular Formula | C26H34N4O2S |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 1-[2-methyl-6-[3-(5-methyl-4-phenylimidazol-1-yl)propylsulfinyl]phenyl]-3-pentylurea |
| SMILES | CCCCCNC(=O)Nc1c(C)cccc1S(=O)CCCn1cnc(-c2ccccc2)c1C |
| InChI | InChI=1S/C26H34N4O2S/c1-4-5-9-16-27-26(31)29-24-20(2)12-10-15-23(24)33(32)18-11-17-30-19-28-25(21(30)3)22-13-7-6-8-14-22/h6-8,10,12-15,19H,4-5,9,11,16-18H2,1-3H3,(H2,27,29,31) |
| InChIKey | IUGWMOAJIKJTCX-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|