C11H16F3N5O2 — CID 103223681
2-[4-[2-(methylamino)ethylamino]-6-oxopyridazin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 103223681) has the molecular formula C11H16F3N5O2 and a molecular weight of 307.28 g/mol. Its IUPAC name is 2-[4-[2-(methylamino)ethylamino]-6-oxopyridazin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[4-[2-(methylamino)ethylamino]-6-oxopyridazin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 103223681 |
| Molecular Formula | C11H16F3N5O2 |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-[4-[2-(methylamino)ethylamino]-6-oxopyridazin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CNCCNc1cnn(CC(=O)NCC(F)(F)F)c(=O)c1 |
| InChI | InChI=1S/C11H16F3N5O2/c1-15-2-3-16-8-4-10(21)19(18-5-8)6-9(20)17-7-11(12,13)14/h4-5,15-16H,2-3,6-7H2,1H3,(H,17,20) |
| InChIKey | NJTDUURPIYQTGG-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|