C13H19ClN6O — CID 103223738
2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-5-[2-(methylamino)ethylamino]pyridazin-3-one (PubChem CID 103223738) has the molecular formula C13H19ClN6O and a molecular weight of 310.79 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-5-[2-(methylamino)ethylamino]pyridazin-3-one.
| Compound Name | 2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-5-[2-(methylamino)ethylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 103223738 |
| Molecular Formula | C13H19ClN6O |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-5-[2-(methylamino)ethylamino]pyridazin-3-one |
| SMILES | CNCCNc1cnn(Cc2c(C)nn(C)c2Cl)c(=O)c1 |
| InChI | InChI=1S/C13H19ClN6O/c1-9-11(13(14)19(3)18-9)8-20-12(21)6-10(7-17-20)16-5-4-15-2/h6-7,15-16H,4-5,8H2,1-3H3 |
| InChIKey | PRTPLBROIUBGPX-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 76.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|