C10H20N2O — CID 103225187
3-methoxy-2-N,2-N-bis(prop-2-enyl)propane-1,2-diamine (PubChem CID 103225187) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 3-methoxy-2-N,2-N-bis(prop-2-enyl)propane-1,2-diamine.
| Compound Name | 3-methoxy-2-N,2-N-bis(prop-2-enyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 103225187 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 3-methoxy-2-N,2-N-bis(prop-2-enyl)propane-1,2-diamine |
| SMILES | C=CCN(CC=C)C(CN)COC |
| InChI | InChI=1S/C10H20N2O/c1-4-6-12(7-5-2)10(8-11)9-13-3/h4-5,10H,1-2,6-9,11H2,3H3 |
| InChIKey | MRXYKQPXACWBIR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|