C13H22N2O — CID 103225288
2-N-benzyl-3-methoxy-1-N,2-N-dimethylpropane-1,2-diamine (PubChem CID 103225288) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-N-benzyl-3-methoxy-1-N,2-N-dimethylpropane-1,2-diamine.
| Compound Name | 2-N-benzyl-3-methoxy-1-N,2-N-dimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 103225288 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 2-N-benzyl-3-methoxy-1-N,2-N-dimethylpropane-1,2-diamine |
| SMILES | CNCC(COC)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C13H22N2O/c1-14-9-13(11-16-3)15(2)10-12-7-5-4-6-8-12/h4-8,13-14H,9-11H2,1-3H3 |
| InChIKey | HXNLLNYRTQDHAT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |