C11H12IN3O8S — CID 10322612
1-[(5S,6R,8R,9R)-4-amino-9-hydroxy-6-(hydroxymethyl)-2,2-dioxo-1,7-dioxa-2lambda6-thiaspiro[4.4]non-3-en-8-yl]-5-iodopyrimidine-2,4-dione (PubChem CID 10322612) has the molecular formula C11H12IN3O8S and a molecular weight of 473.20 g/mol. Its IUPAC name is 1-[(5S,6R,8R,9R)-4-amino-9-hydroxy-6-(hydroxymethyl)-2,2-dioxo-1,7-dioxa-2lambda6-thiaspiro[4.4]non-3-en-8-yl]-5-iodopyrimidine-2,4-dione.
| Compound Name | 1-[(5S,6R,8R,9R)-4-amino-9-hydroxy-6-(hydroxymethyl)-2,2-dioxo-1,7-dioxa-2lambda6-thiaspiro[4.4]non-3-en-8-yl]-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10322612 |
| Molecular Formula | C11H12IN3O8S |
| Molecular Weight | 473.20 g/mol |
| Exact Mass | 472.94 |
| IUPAC Name | 1-[(5S,6R,8R,9R)-4-amino-9-hydroxy-6-(hydroxymethyl)-2,2-dioxo-1,7-dioxa-2lambda6-thiaspiro[4.4]non-3-en-8-yl]-5-iodopyrimidine-2,4-dione |
| SMILES | NC1=CS(=O)(=O)O[C@@]12[C@@H](CO)O[C@@H](n1cc(I)c(=O)[nH]c1=O)[C@@H]2O |
| InChI | InChI=1S/C11H12IN3O8S/c12-4-1-15(10(19)14-8(4)18)9-7(17)11(6(2-16)22-9)5(13)3-24(20,21)23-11/h1,3,6-7,9,16-17H,2,13H2,(H,14,18,19)/t6-,7+,9-,11-/m1/s1 |
| InChIKey | DMLTZZPHLOTGRS-YRCORFKGSA-N |
| XLogP | -2.71 |
| TPSA | 173.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.20 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|