C9H20N2O2 — CID 103226384
3-methoxy-2-(1,4-oxazepan-4-yl)propan-1-amine (PubChem CID 103226384) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-methoxy-2-(1,4-oxazepan-4-yl)propan-1-amine.
| Compound Name | 3-methoxy-2-(1,4-oxazepan-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 103226384 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 3-methoxy-2-(1,4-oxazepan-4-yl)propan-1-amine |
| SMILES | COCC(CN)N1CCCOCC1 |
| InChI | InChI=1S/C9H20N2O2/c1-12-8-9(7-10)11-3-2-5-13-6-4-11/h9H,2-8,10H2,1H3 |
| InChIKey | NEPLLWPBCSJPLR-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |