C10H22N2O3 — CID 114357161
3-amino-4-methoxy-2-(1,4-oxazepan-4-yl)butan-1-ol (PubChem CID 114357161) has the molecular formula C10H22N2O3 and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-amino-4-methoxy-2-(1,4-oxazepan-4-yl)butan-1-ol.
| Compound Name | 3-amino-4-methoxy-2-(1,4-oxazepan-4-yl)butan-1-ol |
|---|---|
| PubChem CID | 114357161 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 3-amino-4-methoxy-2-(1,4-oxazepan-4-yl)butan-1-ol |
| SMILES | COCC(N)C(CO)N1CCCOCC1 |
| InChI | InChI=1S/C10H22N2O3/c1-14-8-9(11)10(7-13)12-3-2-5-15-6-4-12/h9-10,13H,2-8,11H2,1H3 |
| InChIKey | HRCHJDBUASNOFV-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |