C13H28N2O2 — CID 114357158
3-amino-5-methyl-2-(2-methyl-1,4-oxazepan-4-yl)hexan-1-ol (PubChem CID 114357158) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 3-amino-5-methyl-2-(2-methyl-1,4-oxazepan-4-yl)hexan-1-ol.
| Compound Name | 3-amino-5-methyl-2-(2-methyl-1,4-oxazepan-4-yl)hexan-1-ol |
|---|---|
| PubChem CID | 114357158 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 3-amino-5-methyl-2-(2-methyl-1,4-oxazepan-4-yl)hexan-1-ol |
| SMILES | CC(C)CC(N)C(CO)N1CCCOC(C)C1 |
| InChI | InChI=1S/C13H28N2O2/c1-10(2)7-12(14)13(9-16)15-5-4-6-17-11(3)8-15/h10-13,16H,4-9,14H2,1-3H3 |
| InChIKey | UOKIPKYHIDJHLD-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |