C9H18N2OS — CID 62988867
3-(1,4-oxazepan-4-yl)butanethioamide (PubChem CID 62988867) has the molecular formula C9H18N2OS and a molecular weight of 202.32 g/mol. Its IUPAC name is 3-(1,4-oxazepan-4-yl)butanethioamide.
| Compound Name | 3-(1,4-oxazepan-4-yl)butanethioamide |
|---|---|
| PubChem CID | 62988867 |
| Molecular Formula | C9H18N2OS |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 3-(1,4-oxazepan-4-yl)butanethioamide |
| SMILES | CC(CC(N)=S)N1CCCOCC1 |
| InChI | InChI=1S/C9H18N2OS/c1-8(7-9(10)13)11-3-2-5-12-6-4-11/h8H,2-7H2,1H3,(H2,10,13) |
| InChIKey | MFJUBJAWPHYIRC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|