C10H19NO2 — CID 64696480
4-(1,4-oxazepan-4-yl)pentan-2-one (PubChem CID 64696480) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 4-(1,4-oxazepan-4-yl)pentan-2-one.
| Compound Name | 4-(1,4-oxazepan-4-yl)pentan-2-one |
|---|---|
| PubChem CID | 64696480 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 4-(1,4-oxazepan-4-yl)pentan-2-one |
| SMILES | CC(=O)CC(C)N1CCCOCC1 |
| InChI | InChI=1S/C10H19NO2/c1-9(8-10(2)12)11-4-3-6-13-7-5-11/h9H,3-8H2,1-2H3 |
| InChIKey | OSHYQRYKCXJFEK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |