C11H13F3N2O4 — CID 103229408
3-methoxy-2-[4-(trifluoromethoxy)phenoxy]propanehydrazide (PubChem CID 103229408) has the molecular formula C11H13F3N2O4 and a molecular weight of 294.23 g/mol. Its IUPAC name is 3-methoxy-2-[4-(trifluoromethoxy)phenoxy]propanehydrazide.
| Compound Name | 3-methoxy-2-[4-(trifluoromethoxy)phenoxy]propanehydrazide |
|---|---|
| PubChem CID | 103229408 |
| Molecular Formula | C11H13F3N2O4 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 3-methoxy-2-[4-(trifluoromethoxy)phenoxy]propanehydrazide |
| SMILES | COCC(Oc1ccc(OC(F)(F)F)cc1)C(=O)NN |
| InChI | InChI=1S/C11H13F3N2O4/c1-18-6-9(10(17)16-15)19-7-2-4-8(5-3-7)20-11(12,13)14/h2-5,9H,6,15H2,1H3,(H,16,17) |
| InChIKey | BKANQYXCCZNUJA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|