C10H19F3N4O2 — CID 103229575
3-methoxy-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanehydrazide (PubChem CID 103229575) has the molecular formula C10H19F3N4O2 and a molecular weight of 284.28 g/mol. Its IUPAC name is 3-methoxy-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanehydrazide.
| Compound Name | 3-methoxy-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanehydrazide |
|---|---|
| PubChem CID | 103229575 |
| Molecular Formula | C10H19F3N4O2 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 3-methoxy-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanehydrazide |
| SMILES | COCC(C(=O)NN)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H19F3N4O2/c1-19-6-8(9(18)15-14)17-4-2-16(3-5-17)7-10(11,12)13/h8H,2-7,14H2,1H3,(H,15,18) |
| InChIKey | KIUWSRYPELSSKI-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|