C13H23F3N2O2 — CID 78964972
ethyl 2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pentanoate (PubChem CID 78964972) has the molecular formula C13H23F3N2O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is ethyl 2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pentanoate.
| Compound Name | ethyl 2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pentanoate |
|---|---|
| PubChem CID | 78964972 |
| Molecular Formula | C13H23F3N2O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | ethyl 2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pentanoate |
| SMILES | CCCC(C(=O)OCC)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H23F3N2O2/c1-3-5-11(12(19)20-4-2)18-8-6-17(7-9-18)10-13(14,15)16/h11H,3-10H2,1-2H3 |
| InChIKey | IUKXYDSWYAXWBS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |