C10H19NO2 — CID 103231108
3-methyl-4-(pentan-3-ylamino)but-2-enoic acid (PubChem CID 103231108) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 3-methyl-4-(pentan-3-ylamino)but-2-enoic acid.
| Compound Name | 3-methyl-4-(pentan-3-ylamino)but-2-enoic acid |
|---|---|
| PubChem CID | 103231108 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 3-methyl-4-(pentan-3-ylamino)but-2-enoic acid |
| SMILES | CCC(CC)NCC(C)=CC(=O)O |
| InChI | InChI=1S/C10H19NO2/c1-4-9(5-2)11-7-8(3)6-10(12)13/h6,9,11H,4-5,7H2,1-3H3,(H,12,13) |
| InChIKey | NWKPMUJIGJVYRD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|