C10H16F3NO2 — CID 103262025
3-methyl-4-(5,5,5-trifluoropentylamino)but-2-enoic acid (PubChem CID 103262025) has the molecular formula C10H16F3NO2 and a molecular weight of 239.24 g/mol. Its IUPAC name is 3-methyl-4-(5,5,5-trifluoropentylamino)but-2-enoic acid.
| Compound Name | 3-methyl-4-(5,5,5-trifluoropentylamino)but-2-enoic acid |
|---|---|
| PubChem CID | 103262025 |
| Molecular Formula | C10H16F3NO2 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 3-methyl-4-(5,5,5-trifluoropentylamino)but-2-enoic acid |
| SMILES | CC(=CC(=O)O)CNCCCCC(F)(F)F |
| InChI | InChI=1S/C10H16F3NO2/c1-8(6-9(15)16)7-14-5-3-2-4-10(11,12)13/h6,14H,2-5,7H2,1H3,(H,15,16) |
| InChIKey | OHIQPNVYRJFZNY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|