C15H13BrClNO2 — CID 103232223
3-bromo-4-[(3-chloro-2-methylanilino)methyl]benzoic acid (PubChem CID 103232223) has the molecular formula C15H13BrClNO2 and a molecular weight of 354.63 g/mol. Its IUPAC name is 3-bromo-4-[(3-chloro-2-methylanilino)methyl]benzoic acid.
| Compound Name | 3-bromo-4-[(3-chloro-2-methylanilino)methyl]benzoic acid |
|---|---|
| PubChem CID | 103232223 |
| Molecular Formula | C15H13BrClNO2 |
| Molecular Weight | 354.63 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | 3-bromo-4-[(3-chloro-2-methylanilino)methyl]benzoic acid |
| SMILES | Cc1c(Cl)cccc1NCc1ccc(C(=O)O)cc1Br |
| InChI | InChI=1S/C15H13BrClNO2/c1-9-13(17)3-2-4-14(9)18-8-11-6-5-10(15(19)20)7-12(11)16/h2-7,18H,8H2,1H3,(H,19,20) |
| InChIKey | INFCJMKFJWDTDP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.63 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |