C17H16ClFN2O3 — CID 143624740
3-[[[2-(3-chloro-2-methylanilino)acetyl]amino]methyl]-4-fluorobenzoic acid (PubChem CID 143624740) has the molecular formula C17H16ClFN2O3 and a molecular weight of 350.78 g/mol. Its IUPAC name is 3-[[[2-(3-chloro-2-methylanilino)acetyl]amino]methyl]-4-fluorobenzoic acid.
| Compound Name | 3-[[[2-(3-chloro-2-methylanilino)acetyl]amino]methyl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 143624740 |
| Molecular Formula | C17H16ClFN2O3 |
| Molecular Weight | 350.78 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 3-[[[2-(3-chloro-2-methylanilino)acetyl]amino]methyl]-4-fluorobenzoic acid |
| SMILES | Cc1c(Cl)cccc1NCC(=O)NCc1cc(C(=O)O)ccc1F |
| InChI | InChI=1S/C17H16ClFN2O3/c1-10-13(18)3-2-4-15(10)20-9-16(22)21-8-12-7-11(17(23)24)5-6-14(12)19/h2-7,20H,8-9H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | CNAIXJLHJPCJMN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.78 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |