C26H28N4O4S — CID 10323391
6-cyclopentyl-6-[2-(4-methoxyphenyl)ethyl]-3-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione (PubChem CID 10323391) has the molecular formula C26H28N4O4S and a molecular weight of 492.60 g/mol. Its IUPAC name is 6-cyclopentyl-6-[2-(4-methoxyphenyl)ethyl]-3-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-6-[2-(4-methoxyphenyl)ethyl]-3-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 10323391 |
| Molecular Formula | C26H28N4O4S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 6-cyclopentyl-6-[2-(4-methoxyphenyl)ethyl]-3-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(Sc3n[nH]c(-c4ccncc4)n3)C(=O)O2)cc1 |
| InChI | InChI=1S/C26H28N4O4S/c1-33-20-8-6-17(7-9-20)10-13-26(19-4-2-3-5-19)16-21(31)22(24(32)34-26)35-25-28-23(29-30-25)18-11-14-27-15-12-18/h6-9,11-12,14-15,19,22H,2-5,10,13,16H2,1H3,(H,28,29,30) |
| InChIKey | XYNHFQCLNKKEPN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|