C24H27N5O4S — CID 10480358
3-[(4-amino-1H-pyrazolo[3,4-d]pyrimidin-6-yl)sulfanyl]-6-cyclopentyl-6-[2-(4-methoxyphenyl)ethyl]oxane-2,4-dione (PubChem CID 10480358) has the molecular formula C24H27N5O4S and a molecular weight of 481.58 g/mol. Its IUPAC name is 3-[(4-amino-1H-pyrazolo[3,4-d]pyrimidin-6-yl)sulfanyl]-6-cyclopentyl-6-[2-(4-methoxyphenyl)ethyl]oxane-2,4-dione.
| Compound Name | 3-[(4-amino-1H-pyrazolo[3,4-d]pyrimidin-6-yl)sulfanyl]-6-cyclopentyl-6-[2-(4-methoxyphenyl)ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 10480358 |
| Molecular Formula | C24H27N5O4S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 3-[(4-amino-1H-pyrazolo[3,4-d]pyrimidin-6-yl)sulfanyl]-6-cyclopentyl-6-[2-(4-methoxyphenyl)ethyl]oxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(Sc3nc(N)c4cn[nH]c4n3)C(=O)O2)cc1 |
| InChI | InChI=1S/C24H27N5O4S/c1-32-16-8-6-14(7-9-16)10-11-24(15-4-2-3-5-15)12-18(30)19(22(31)33-24)34-23-27-20(25)17-13-26-29-21(17)28-23/h6-9,13,15,19H,2-5,10-12H2,1H3,(H3,25,26,27,28,29) |
| InChIKey | QBYPUESIVWBEFD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 133.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|