C23H34O12 — CID 10323782
[(3S,4S,5R)-5-[(3R)-4-[(3aR,5R,6S,6aR)-6-acetyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-acetyloxybut-1-en-2-yl]-4-(methoxymethoxy)oxolan-3-yl] acetate (PubChem CID 10323782) has the molecular formula C23H34O12 and a molecular weight of 502.51 g/mol. Its IUPAC name is [(3S,4S,5R)-5-[(3R)-4-[(3aR,5R,6S,6aR)-6-acetyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-acetyloxybut-1-en-2-yl]-4-(methoxymethoxy)oxolan-3-yl] acetate.
| Compound Name | [(3S,4S,5R)-5-[(3R)-4-[(3aR,5R,6S,6aR)-6-acetyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-acetyloxybut-1-en-2-yl]-4-(methoxymethoxy)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 10323782 |
| Molecular Formula | C23H34O12 |
| Molecular Weight | 502.51 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | [(3S,4S,5R)-5-[(3R)-4-[(3aR,5R,6S,6aR)-6-acetyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-acetyloxybut-1-en-2-yl]-4-(methoxymethoxy)oxolan-3-yl] acetate |
| SMILES | C=C([C@H]1OC[C@H](OC(C)=O)[C@H]1OCOC)[C@@H](C[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C23H34O12/c1-11(18-19(29-10-27-7)17(9-28-18)31-13(3)25)15(30-12(2)24)8-16-20(32-14(4)26)21-22(33-16)35-23(5,6)34-21/h15-22H,1,8-10H2,2-7H3/t15-,16-,17+,18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | FPVZNAWPNQPSKJ-GHOSLLHMSA-N |
| XLogP | 0.99 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.51 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|