C23H20Cl3N5O2 — CID 10323870
[3,5-dichloro-4-[4-(3-chlorophenyl)-5-[2-(2-methoxyethylamino)pyrimidin-4-yl]-1H-imidazol-2-yl]phenyl]methanol (PubChem CID 10323870) has the molecular formula C23H20Cl3N5O2 and a molecular weight of 504.81 g/mol. Its IUPAC name is [3,5-dichloro-4-[4-(3-chlorophenyl)-5-[2-(2-methoxyethylamino)pyrimidin-4-yl]-1H-imidazol-2-yl]phenyl]methanol.
| Compound Name | [3,5-dichloro-4-[4-(3-chlorophenyl)-5-[2-(2-methoxyethylamino)pyrimidin-4-yl]-1H-imidazol-2-yl]phenyl]methanol |
|---|---|
| PubChem CID | 10323870 |
| Molecular Formula | C23H20Cl3N5O2 |
| Molecular Weight | 504.81 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | [3,5-dichloro-4-[4-(3-chlorophenyl)-5-[2-(2-methoxyethylamino)pyrimidin-4-yl]-1H-imidazol-2-yl]phenyl]methanol |
| SMILES | COCCNc1nccc(-c2[nH]c(-c3c(Cl)cc(CO)cc3Cl)nc2-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C23H20Cl3N5O2/c1-33-8-7-28-23-27-6-5-18(29-23)21-20(14-3-2-4-15(24)11-14)30-22(31-21)19-16(25)9-13(12-32)10-17(19)26/h2-6,9-11,32H,7-8,12H2,1H3,(H,30,31)(H,27,28,29) |
| InChIKey | NJLLIHQBNKXJBB-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 95.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.81 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|