C10H20N2O4S — CID 103239007
methyl 2-ethyl-4-[2-(methanesulfonamido)ethylamino]but-2-enoate (PubChem CID 103239007) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is methyl 2-ethyl-4-[2-(methanesulfonamido)ethylamino]but-2-enoate.
| Compound Name | methyl 2-ethyl-4-[2-(methanesulfonamido)ethylamino]but-2-enoate |
|---|---|
| PubChem CID | 103239007 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | methyl 2-ethyl-4-[2-(methanesulfonamido)ethylamino]but-2-enoate |
| SMILES | CCC(=CCNCCNS(C)(=O)=O)C(=O)OC |
| InChI | InChI=1S/C10H20N2O4S/c1-4-9(10(13)16-2)5-6-11-7-8-12-17(3,14)15/h5,11-12H,4,6-8H2,1-3H3 |
| InChIKey | UJYYRZSQGYAHON-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|