C13H26N2O4S — CID 103241540
methyl (Z)-2-ethyl-4-[3-[ethyl(methylsulfonyl)amino]propylamino]but-2-enoate (PubChem CID 103241540) has the molecular formula C13H26N2O4S and a molecular weight of 306.43 g/mol. Its IUPAC name is methyl (Z)-2-ethyl-4-[3-[ethyl(methylsulfonyl)amino]propylamino]but-2-enoate.
| Compound Name | methyl (Z)-2-ethyl-4-[3-[ethyl(methylsulfonyl)amino]propylamino]but-2-enoate |
|---|---|
| PubChem CID | 103241540 |
| Molecular Formula | C13H26N2O4S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | methyl (Z)-2-ethyl-4-[3-[ethyl(methylsulfonyl)amino]propylamino]but-2-enoate |
| SMILES | CC/C(=C/CNCCCN(CC)S(C)(=O)=O)C(=O)OC |
| InChI | InChI=1S/C13H26N2O4S/c1-5-12(13(16)19-3)8-10-14-9-7-11-15(6-2)20(4,17)18/h8,14H,5-7,9-11H2,1-4H3/b12-8- |
| InChIKey | DSUJMPNQEXNLAK-WQLSENKSSA-N |
| XLogP | 0.76 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|