C12H24N2O4S — CID 103241555
(Z)-2-ethyl-4-[3-[ethyl(methylsulfonyl)amino]propylamino]but-2-enoic acid (PubChem CID 103241555) has the molecular formula C12H24N2O4S and a molecular weight of 292.40 g/mol. Its IUPAC name is (Z)-2-ethyl-4-[3-[ethyl(methylsulfonyl)amino]propylamino]but-2-enoic acid.
| Compound Name | (Z)-2-ethyl-4-[3-[ethyl(methylsulfonyl)amino]propylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 103241555 |
| Molecular Formula | C12H24N2O4S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (Z)-2-ethyl-4-[3-[ethyl(methylsulfonyl)amino]propylamino]but-2-enoic acid |
| SMILES | CC/C(=C/CNCCCN(CC)S(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C12H24N2O4S/c1-4-11(12(15)16)7-9-13-8-6-10-14(5-2)19(3,17)18/h7,13H,4-6,8-10H2,1-3H3,(H,15,16)/b11-7- |
| InChIKey | BZXDZTAWNAMXFM-XFFZJAGNSA-N |
| XLogP | 0.67 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|