C13H26N2O2 — CID 103234588
(Z)-4-[3-(diethylamino)propylamino]-2-ethylbut-2-enoic acid (PubChem CID 103234588) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is (Z)-4-[3-(diethylamino)propylamino]-2-ethylbut-2-enoic acid.
| Compound Name | (Z)-4-[3-(diethylamino)propylamino]-2-ethylbut-2-enoic acid |
|---|---|
| PubChem CID | 103234588 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | (Z)-4-[3-(diethylamino)propylamino]-2-ethylbut-2-enoic acid |
| SMILES | CC/C(=C/CNCCCN(CC)CC)C(=O)O |
| InChI | InChI=1S/C13H26N2O2/c1-4-12(13(16)17)8-10-14-9-7-11-15(5-2)6-3/h8,14H,4-7,9-11H2,1-3H3,(H,16,17)/b12-8- |
| InChIKey | HXGLOAHQLYWPIC-WQLSENKSSA-N |
| XLogP | 1.73 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|