C9H15NO4 — CID 103240366
2-cyclopropyl-2-[(3-methoxy-3-oxopropyl)amino]acetic acid (PubChem CID 103240366) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-cyclopropyl-2-[(3-methoxy-3-oxopropyl)amino]acetic acid.
| Compound Name | 2-cyclopropyl-2-[(3-methoxy-3-oxopropyl)amino]acetic acid |
|---|---|
| PubChem CID | 103240366 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 2-cyclopropyl-2-[(3-methoxy-3-oxopropyl)amino]acetic acid |
| SMILES | COC(=O)CCNC(C(=O)O)C1CC1 |
| InChI | InChI=1S/C9H15NO4/c1-14-7(11)4-5-10-8(9(12)13)6-2-3-6/h6,8,10H,2-5H2,1H3,(H,12,13) |
| InChIKey | OFYXCWPSSSKKSI-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |