C10H19NO4 — CID 106248256
2-cyclopropyl-2-[(3-hydroxy-4-methoxybutyl)amino]acetic acid (PubChem CID 106248256) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is 2-cyclopropyl-2-[(3-hydroxy-4-methoxybutyl)amino]acetic acid.
| Compound Name | 2-cyclopropyl-2-[(3-hydroxy-4-methoxybutyl)amino]acetic acid |
|---|---|
| PubChem CID | 106248256 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2-cyclopropyl-2-[(3-hydroxy-4-methoxybutyl)amino]acetic acid |
| SMILES | COCC(O)CCNC(C(=O)O)C1CC1 |
| InChI | InChI=1S/C10H19NO4/c1-15-6-8(12)4-5-11-9(10(13)14)7-2-3-7/h7-9,11-12H,2-6H2,1H3,(H,13,14) |
| InChIKey | MNINYINUYKWOFO-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |