C11H16BrNO3S — CID 103241101
ethyl 4-[(5-bromothiophen-2-yl)methylamino]-3-hydroxybutanoate (PubChem CID 103241101) has the molecular formula C11H16BrNO3S and a molecular weight of 322.22 g/mol. Its IUPAC name is ethyl 4-[(5-bromothiophen-2-yl)methylamino]-3-hydroxybutanoate.
| Compound Name | ethyl 4-[(5-bromothiophen-2-yl)methylamino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 103241101 |
| Molecular Formula | C11H16BrNO3S |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | ethyl 4-[(5-bromothiophen-2-yl)methylamino]-3-hydroxybutanoate |
| SMILES | CCOC(=O)CC(O)CNCc1ccc(Br)s1 |
| InChI | InChI=1S/C11H16BrNO3S/c1-2-16-11(15)5-8(14)6-13-7-9-3-4-10(12)17-9/h3-4,8,13-14H,2,5-7H2,1H3 |
| InChIKey | JAABCIDUDUJXMF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |